C19H30O2 — CID 59934824
(3aR,7aR)-1-[(2R)-1-(4-hydroxy-4-methylcyclopent-2-en-1-yl)propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 59934824) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is (3aR,7aR)-1-[(2R)-1-(4-hydroxy-4-methylcyclopent-2-en-1-yl)propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | (3aR,7aR)-1-[(2R)-1-(4-hydroxy-4-methylcyclopent-2-en-1-yl)propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 59934824 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (3aR,7aR)-1-[(2R)-1-(4-hydroxy-4-methylcyclopent-2-en-1-yl)propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | C[C@H](CC1C=CC(C)(O)C1)C1CC[C@H]2C(=O)CCC[C@]12C |
| InChI | InChI=1S/C19H30O2/c1-13(11-14-8-10-18(2,21)12-14)15-6-7-16-17(20)5-4-9-19(15,16)3/h8,10,13-16,21H,4-7,9,11-12H2,1-3H3/t13-,14?,15?,16+,18?,19-/m1/s1 |
| InChIKey | ULHTVXHMJQBRFH-DKUMDXKRSA-N |
| XLogP | 4.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|