C16H24O3 — CID 59934893
(2E,4E)-5-(1,4-dioxaspiro[4.5]decan-6-yl)-3,4-dimethylhexa-2,4-dienal (PubChem CID 59934893) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is (2E,4E)-5-(1,4-dioxaspiro[4.5]decan-6-yl)-3,4-dimethylhexa-2,4-dienal.
| Compound Name | (2E,4E)-5-(1,4-dioxaspiro[4.5]decan-6-yl)-3,4-dimethylhexa-2,4-dienal |
|---|---|
| PubChem CID | 59934893 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (2E,4E)-5-(1,4-dioxaspiro[4.5]decan-6-yl)-3,4-dimethylhexa-2,4-dienal |
| SMILES | CC(=C\C=O)/C(C)=C(\C)C1CCCCC12OCCO2 |
| InChI | InChI=1S/C16H24O3/c1-12(7-9-17)13(2)14(3)15-6-4-5-8-16(15)18-10-11-19-16/h7,9,15H,4-6,8,10-11H2,1-3H3/b12-7+,14-13+ |
| InChIKey | XSPRRAMTOZFHKY-MZXMXVKLSA-N |
| XLogP | 3.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|