C22H29N7O — CID 59936221
N-[6-[(4-cyano-1-ethyl-3-methylpyrazol-5-yl)diazenyl]-1,2,2,4-tetramethyl-3,4-dihydroquinolin-7-yl]acetamide (PubChem CID 59936221) has the molecular formula C22H29N7O and a molecular weight of 407.52 g/mol. Its IUPAC name is N-[6-[(4-cyano-1-ethyl-3-methylpyrazol-5-yl)diazenyl]-1,2,2,4-tetramethyl-3,4-dihydroquinolin-7-yl]acetamide.
| Compound Name | N-[6-[(4-cyano-1-ethyl-3-methylpyrazol-5-yl)diazenyl]-1,2,2,4-tetramethyl-3,4-dihydroquinolin-7-yl]acetamide |
|---|---|
| PubChem CID | 59936221 |
| Molecular Formula | C22H29N7O |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | N-[6-[(4-cyano-1-ethyl-3-methylpyrazol-5-yl)diazenyl]-1,2,2,4-tetramethyl-3,4-dihydroquinolin-7-yl]acetamide |
| SMILES | CCn1nc(C)c(C#N)c1/N=N/c1cc2c(cc1NC(C)=O)N(C)C(C)(C)CC2C |
| InChI | InChI=1S/C22H29N7O/c1-8-29-21(17(12-23)14(3)27-29)26-25-19-9-16-13(2)11-22(5,6)28(7)20(16)10-18(19)24-15(4)30/h9-10,13H,8,11H2,1-7H3,(H,24,30)/b26-25+ |
| InChIKey | JIANNLVRPATRSY-OCEACIFDSA-N |
| XLogP | 5.18 |
| TPSA | 98.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|