C12H29Cl2MnN5 — CID 59936314
cis-(2S,6R)-2,6-dimethyl-1,4,7,10,13-pentazacyclopentadecane;dichloromanganese (PubChem CID 59936314) has the molecular formula C12H29Cl2MnN5 and a molecular weight of 369.24 g/mol. Its IUPAC name is cis-(2S,6R)-2,6-dimethyl-1,4,7,10,13-pentazacyclopentadecane;dichloromanganese.
| Compound Name | cis-(2S,6R)-2,6-dimethyl-1,4,7,10,13-pentazacyclopentadecane;dichloromanganese |
|---|---|
| PubChem CID | 59936314 |
| Molecular Formula | C12H29Cl2MnN5 |
| Molecular Weight | 369.24 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | cis-(2S,6R)-2,6-dimethyl-1,4,7,10,13-pentazacyclopentadecane;dichloromanganese |
| SMILES | C[C@@H]1CNC[C@H](C)NCCNCCNCCN1.Cl[Mn]Cl |
| InChI | InChI=1S/C12H29N5.2ClH.Mn/c1-11-9-15-10-12(2)17-8-6-14-4-3-13-5-7-16-11;;;/h11-17H,3-10H2,1-2H3;2*1H;/q;;;+2/p-2/t11-,12+;;; |
| InChIKey | LKAQVVANFVFHGZ-JXAYLMDHSA-L |
| XLogP | 0.10 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.24 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |