About 5-methyl-3a,4,5,6-tetrahydropyrrolo[3,2-b]pyrrole
5-methyl-3a,4,5,6-tetrahydropyrrolo[3,2-b]pyrrole (PubChem CID 59936373) has the molecular formula C7H10N2
and a molecular weight of 122.17 g/mol. Its IUPAC name is 5-methyl-3a,4,5,6-tetrahydropyrrolo[3,2-b]pyrrole.
Analyze 5-methyl-3a,4,5,6-tetrahydropyrrolo[3,2-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3a,4,5,6-tetrahydropyrrolo[3,2-b]pyrrole?
The IUPAC name of 5-methyl-3a,4,5,6-tetrahydropyrrolo[3,2-b]pyrrole (CID 59936373) is 5-methyl-3a,4,5,6-tetrahydropyrrolo[3,2-b]pyrrole.
What is the SMILES notation for 5-methyl-3a,4,5,6-tetrahydropyrrolo[3,2-b]pyrrole?
The canonical SMILES for 5-methyl-3a,4,5,6-tetrahydropyrrolo[3,2-b]pyrrole is CC1CC2=NC=CC2N1.
What is the InChIKey of 5-methyl-3a,4,5,6-tetrahydropyrrolo[3,2-b]pyrrole?
The InChIKey is BRJAKQQQJQCJLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2/c1-5-4-7-6(9-5)2-3-8-7/h2-3,5-6,9H,4H2,1H3.
What are the key properties of 5-methyl-3a,4,5,6-tetrahydropyrrolo[3,2-b]pyrrole?
5-methyl-3a,4,5,6-tetrahydropyrrolo[3,2-b]pyrrole has a molecular weight of 122.17 g/mol, XLogP of 0.71, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3a,4,5,6-tetrahydropyrrolo[3,2-b]pyrrole is sourced from PubChem (CID 59936373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).