About (4R)-1,4-dimethyl-2-prop-1-enylpyrrolidine
(4R)-1,4-dimethyl-2-prop-1-enylpyrrolidine (PubChem CID 59936388) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is (4R)-1,4-dimethyl-2-prop-1-enylpyrrolidine.
Molecular Properties
| Compound Name | (4R)-1,4-dimethyl-2-prop-1-enylpyrrolidine |
| PubChem CID | 59936388 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | (4R)-1,4-dimethyl-2-prop-1-enylpyrrolidine |
| SMILES | CC=CC1C[C@@H](C)CN1C |
| InChI | InChI=1S/C9H17N/c1-4-5-9-6-8(2)7-10(9)3/h4-5,8-9H,6-7H2,1-3H3/t8-,9?/m1/s1 |
| InChIKey | SERJEUKZKLICEU-VEDVMXKPSA-N |
| XLogP | 1.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R)-1,4-dimethyl-2-prop-1-enylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-1,4-dimethyl-2-prop-1-enylpyrrolidine?
The IUPAC name of (4R)-1,4-dimethyl-2-prop-1-enylpyrrolidine (CID 59936388) is (4R)-1,4-dimethyl-2-prop-1-enylpyrrolidine.
What is the SMILES notation for (4R)-1,4-dimethyl-2-prop-1-enylpyrrolidine?
The canonical SMILES for (4R)-1,4-dimethyl-2-prop-1-enylpyrrolidine is CC=CC1C[C@@H](C)CN1C.
What is the InChIKey of (4R)-1,4-dimethyl-2-prop-1-enylpyrrolidine?
The InChIKey is SERJEUKZKLICEU-VEDVMXKPSA-N. The full InChI is InChI=1S/C9H17N/c1-4-5-9-6-8(2)7-10(9)3/h4-5,8-9H,6-7H2,1-3H3/t8-,9?/m1/s1.
What are the key properties of (4R)-1,4-dimethyl-2-prop-1-enylpyrrolidine?
(4R)-1,4-dimethyl-2-prop-1-enylpyrrolidine has a molecular weight of 139.24 g/mol, XLogP of 1.90, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-1,4-dimethyl-2-prop-1-enylpyrrolidine is sourced from PubChem (CID 59936388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).