About (2S)-N-[(2S,3R)-4-(dimethylamino)-3-hydroxybutan-2-yl]-2-methyl-3-methylsulfanylpropanamide
(2S)-N-[(2S,3R)-4-(dimethylamino)-3-hydroxybutan-2-yl]-2-methyl-3-methylsulfanylpropanamide (PubChem CID 59936555) has the molecular formula C11H24N2O2S
and a molecular weight of 248.39 g/mol. Its IUPAC name is (2S)-N-[(2S,3R)-4-(dimethylamino)-3-hydroxybutan-2-yl]-2-methyl-3-methylsulfanylpropanamide.
Molecular Properties
| Compound Name | (2S)-N-[(2S,3R)-4-(dimethylamino)-3-hydroxybutan-2-yl]-2-methyl-3-methylsulfanylpropanamide |
| PubChem CID | 59936555 |
| Molecular Formula | C11H24N2O2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | (2S)-N-[(2S,3R)-4-(dimethylamino)-3-hydroxybutan-2-yl]-2-methyl-3-methylsulfanylpropanamide |
| SMILES | CSC[C@@H](C)C(=O)N[C@@H](C)[C@H](O)CN(C)C |
| InChI | InChI=1S/C11H24N2O2S/c1-8(7-16-5)11(15)12-9(2)10(14)6-13(3)4/h8-10,14H,6-7H2,1-5H3,(H,12,15)/t8-,9+,10-/m1/s1 |
| InChIKey | RYHBVCOXBUEWDB-KXUCPTDWSA-N |
| XLogP | 0.41 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-N-[(2S,3R)-4-(dimethylamino)-3-hydroxybutan-2-yl]-2-methyl-3-methylsulfanylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-[(2S,3R)-4-(dimethylamino)-3-hydroxybutan-2-yl]-2-methyl-3-methylsulfanylpropanamide?
The IUPAC name of (2S)-N-[(2S,3R)-4-(dimethylamino)-3-hydroxybutan-2-yl]-2-methyl-3-methylsulfanylpropanamide (CID 59936555) is (2S)-N-[(2S,3R)-4-(dimethylamino)-3-hydroxybutan-2-yl]-2-methyl-3-methylsulfanylpropanamide.
What is the SMILES notation for (2S)-N-[(2S,3R)-4-(dimethylamino)-3-hydroxybutan-2-yl]-2-methyl-3-methylsulfanylpropanamide?
The canonical SMILES for (2S)-N-[(2S,3R)-4-(dimethylamino)-3-hydroxybutan-2-yl]-2-methyl-3-methylsulfanylpropanamide is CSC[C@@H](C)C(=O)N[C@@H](C)[C@H](O)CN(C)C.
What is the InChIKey of (2S)-N-[(2S,3R)-4-(dimethylamino)-3-hydroxybutan-2-yl]-2-methyl-3-methylsulfanylpropanamide?
The InChIKey is RYHBVCOXBUEWDB-KXUCPTDWSA-N. The full InChI is InChI=1S/C11H24N2O2S/c1-8(7-16-5)11(15)12-9(2)10(14)6-13(3)4/h8-10,14H,6-7H2,1-5H3,(H,12,15)/t8-,9+,10-/m1/s1.
What are the key properties of (2S)-N-[(2S,3R)-4-(dimethylamino)-3-hydroxybutan-2-yl]-2-methyl-3-methylsulfanylpropanamide?
(2S)-N-[(2S,3R)-4-(dimethylamino)-3-hydroxybutan-2-yl]-2-methyl-3-methylsulfanylpropanamide has a molecular weight of 248.39 g/mol, XLogP of 0.41, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-[(2S,3R)-4-(dimethylamino)-3-hydroxybutan-2-yl]-2-methyl-3-methylsulfanylpropanamide is sourced from PubChem (CID 59936555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).