About 1-methoxy-3-methyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane
1-methoxy-3-methyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane (PubChem CID 59936764) has the molecular formula C8H17NO4Si
and a molecular weight of 219.31 g/mol. Its IUPAC name is 1-methoxy-3-methyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane.
Molecular Properties
| Compound Name | 1-methoxy-3-methyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane |
| PubChem CID | 59936764 |
| Molecular Formula | C8H17NO4Si |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 1-methoxy-3-methyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane |
| SMILES | CO[Si]12OCCN(CCO1)CC(C)O2 |
| InChI | InChI=1S/C8H17NO4Si/c1-8-7-9-3-5-11-14(10-2,13-8)12-6-4-9/h8H,3-7H2,1-2H3 |
| InChIKey | QTKWOYJEBHBNSZ-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-3-methyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-3-methyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane?
The IUPAC name of 1-methoxy-3-methyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane (CID 59936764) is 1-methoxy-3-methyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane.
What is the SMILES notation for 1-methoxy-3-methyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane?
The canonical SMILES for 1-methoxy-3-methyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane is CO[Si]12OCCN(CCO1)CC(C)O2.
What is the InChIKey of 1-methoxy-3-methyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane?
The InChIKey is QTKWOYJEBHBNSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO4Si/c1-8-7-9-3-5-11-14(10-2,13-8)12-6-4-9/h8H,3-7H2,1-2H3.
What are the key properties of 1-methoxy-3-methyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane?
1-methoxy-3-methyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane has a molecular weight of 219.31 g/mol, XLogP of -0.16, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-3-methyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecane is sourced from PubChem (CID 59936764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).