C13H29N3O3Si — CID 59936779
N'-[3-(3,7-dimethyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]ethane-1,2-diamine (PubChem CID 59936779) has the molecular formula C13H29N3O3Si and a molecular weight of 303.48 g/mol. Its IUPAC name is N'-[3-(3,7-dimethyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]ethane-1,2-diamine.
| Compound Name | N'-[3-(3,7-dimethyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 59936779 |
| Molecular Formula | C13H29N3O3Si |
| Molecular Weight | 303.48 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | N'-[3-(3,7-dimethyl-2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]ethane-1,2-diamine |
| SMILES | CC1CN2CCO[Si](CCCNCCN)(O1)OC(C)C2 |
| InChI | InChI=1S/C13H29N3O3Si/c1-12-10-16-7-8-17-20(18-12,19-13(2)11-16)9-3-5-15-6-4-14/h12-13,15H,3-11,14H2,1-2H3 |
| InChIKey | DQQSXGWRUYVARD-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 68.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.48 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|