About (3-chloro-2-hydroxypropyl) hydroxy hydrogen phosphite
(3-chloro-2-hydroxypropyl) hydroxy hydrogen phosphite (PubChem CID 59937036) has the molecular formula C3H8ClO5P
and a molecular weight of 190.52 g/mol. Its IUPAC name is (3-chloro-2-hydroxypropyl) hydroxy hydrogen phosphite.
Molecular Properties
| Compound Name | (3-chloro-2-hydroxypropyl) hydroxy hydrogen phosphite |
| PubChem CID | 59937036 |
| Molecular Formula | C3H8ClO5P |
| Molecular Weight | 190.52 g/mol |
| Exact Mass | 189.98 |
| IUPAC Name | (3-chloro-2-hydroxypropyl) hydroxy hydrogen phosphite |
| SMILES | OOP(O)OCC(O)CCl |
| InChI | InChI=1S/C3H8ClO5P/c4-1-3(5)2-8-10(7)9-6/h3,5-7H,1-2H2 |
| InChIKey | WSVLSFQLBCHWSH-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.52 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3-chloro-2-hydroxypropyl) hydroxy hydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chloro-2-hydroxypropyl) hydroxy hydrogen phosphite?
The IUPAC name of (3-chloro-2-hydroxypropyl) hydroxy hydrogen phosphite (CID 59937036) is (3-chloro-2-hydroxypropyl) hydroxy hydrogen phosphite.
What is the SMILES notation for (3-chloro-2-hydroxypropyl) hydroxy hydrogen phosphite?
The canonical SMILES for (3-chloro-2-hydroxypropyl) hydroxy hydrogen phosphite is OOP(O)OCC(O)CCl.
What is the InChIKey of (3-chloro-2-hydroxypropyl) hydroxy hydrogen phosphite?
The InChIKey is WSVLSFQLBCHWSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8ClO5P/c4-1-3(5)2-8-10(7)9-6/h3,5-7H,1-2H2.
What are the key properties of (3-chloro-2-hydroxypropyl) hydroxy hydrogen phosphite?
(3-chloro-2-hydroxypropyl) hydroxy hydrogen phosphite has a molecular weight of 190.52 g/mol, XLogP of 0.31, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chloro-2-hydroxypropyl) hydroxy hydrogen phosphite is sourced from PubChem (CID 59937036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).