C16H16O5S — CID 59937082
2-[2-(8-formyl-4-hydroxy-3-methylnaphthalen-1-yl)oxyethylsulfanyl]acetic acid (PubChem CID 59937082) has the molecular formula C16H16O5S and a molecular weight of 320.37 g/mol. Its IUPAC name is 2-[2-(8-formyl-4-hydroxy-3-methylnaphthalen-1-yl)oxyethylsulfanyl]acetic acid.
| Compound Name | 2-[2-(8-formyl-4-hydroxy-3-methylnaphthalen-1-yl)oxyethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 59937082 |
| Molecular Formula | C16H16O5S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 2-[2-(8-formyl-4-hydroxy-3-methylnaphthalen-1-yl)oxyethylsulfanyl]acetic acid |
| SMILES | Cc1cc(OCCSCC(=O)O)c2c(C=O)cccc2c1O |
| InChI | InChI=1S/C16H16O5S/c1-10-7-13(21-5-6-22-9-14(18)19)15-11(8-17)3-2-4-12(15)16(10)20/h2-4,7-8,20H,5-6,9H2,1H3,(H,18,19) |
| InChIKey | KEVRUBWATIRYAU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|