C4H4F5ORf- — CID 59937283
1,1,1,2,3-pentafluoro-2-methanidyloxypropane;rutherfordium (PubChem CID 59937283) has the molecular formula C4H4F5ORf- and a molecular weight of 430.07 g/mol. Its IUPAC name is 1,1,1,2,3-pentafluoro-2-methanidyloxypropane;rutherfordium.
| Compound Name | 1,1,1,2,3-pentafluoro-2-methanidyloxypropane;rutherfordium |
|---|---|
| PubChem CID | 59937283 |
| Molecular Formula | C4H4F5ORf- |
| Molecular Weight | 430.07 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 1,1,1,2,3-pentafluoro-2-methanidyloxypropane;rutherfordium |
| SMILES | [CH2-]OC(F)(CF)C(F)(F)F.[Rf] |
| InChI | InChI=1S/C4H4F5O.Rf/c1-10-3(6,2-5)4(7,8)9;/h1-2H2;/q-1; |
| InChIKey | OFUNMPYMHUFGLB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.07 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|