C23H20N5OS2+ — CID 59937314
2-[3-(4-methoxy-3-methylphenyl)-5-thiophen-2-yltetrazol-2-ium-2-yl]-5-methyl-4-phenyl-1,3-thiazole (PubChem CID 59937314) has the molecular formula C23H20N5OS2+ and a molecular weight of 446.58 g/mol. Its IUPAC name is 2-[3-(4-methoxy-3-methylphenyl)-5-thiophen-2-yltetrazol-2-ium-2-yl]-5-methyl-4-phenyl-1,3-thiazole.
| Compound Name | 2-[3-(4-methoxy-3-methylphenyl)-5-thiophen-2-yltetrazol-2-ium-2-yl]-5-methyl-4-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 59937314 |
| Molecular Formula | C23H20N5OS2+ |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 2-[3-(4-methoxy-3-methylphenyl)-5-thiophen-2-yltetrazol-2-ium-2-yl]-5-methyl-4-phenyl-1,3-thiazole |
| SMILES | COc1ccc(-n2nc(-c3cccs3)n[n+]2-c2nc(-c3ccccc3)c(C)s2)cc1C |
| InChI | InChI=1S/C23H20N5OS2/c1-15-14-18(11-12-19(15)29-3)27-25-22(20-10-7-13-30-20)26-28(27)23-24-21(16(2)31-23)17-8-5-4-6-9-17/h4-14H,1-3H3/q+1 |
| InChIKey | QHLBABSTFPBCKN-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|