C12H19N2+ — CID 59937465
methyl-[5-methyl-9-(methylamino)nona-2,4,6,8-tetraenylidene]azanium (PubChem CID 59937465) has the molecular formula C12H19N2+ and a molecular weight of 191.30 g/mol. Its IUPAC name is methyl-[5-methyl-9-(methylamino)nona-2,4,6,8-tetraenylidene]azanium.
| Compound Name | methyl-[5-methyl-9-(methylamino)nona-2,4,6,8-tetraenylidene]azanium |
|---|---|
| PubChem CID | 59937465 |
| Molecular Formula | C12H19N2+ |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.15 |
| IUPAC Name | methyl-[5-methyl-9-(methylamino)nona-2,4,6,8-tetraenylidene]azanium |
| SMILES | CNC=CC=CC(C)=CC=C/C=[NH+]/C |
| InChI | InChI=1S/C12H18N2/c1-12(8-4-6-10-13-2)9-5-7-11-14-3/h4-11,13H,1-3H3/p+1/b7-5?,8-4?,10-6?,12-9?,14-11+ |
| InChIKey | OVJYJKXCTNFGRK-LQFFSHQESA-O |
| XLogP | 0.56 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|