C12H18N2 — CID 59937466
N,5-dimethyl-9-methyliminonona-1,3,5,7-tetraen-1-amine (PubChem CID 59937466) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is N,5-dimethyl-9-methyliminonona-1,3,5,7-tetraen-1-amine.
| Compound Name | N,5-dimethyl-9-methyliminonona-1,3,5,7-tetraen-1-amine |
|---|---|
| PubChem CID | 59937466 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | N,5-dimethyl-9-methyliminonona-1,3,5,7-tetraen-1-amine |
| SMILES | C/N=C/C=CC=C(C)C=CC=CNC |
| InChI | InChI=1S/C12H18N2/c1-12(8-4-6-10-13-2)9-5-7-11-14-3/h4-11,13H,1-3H3/b7-5?,8-4?,10-6?,12-9?,14-11+ |
| InChIKey | OVJYJKXCTNFGRK-LQFFSHQESA-N |
| XLogP | 2.48 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|