C18H14N2O5S3 — CID 59937892
[(2Z)-2-(3-benzyl-4-oxo-2-sulfanylidene-1,3-oxazolidin-5-ylidene)-1,3-benzothiazol-3-yl]methanesulfonic acid (PubChem CID 59937892) has the molecular formula C18H14N2O5S3 and a molecular weight of 434.52 g/mol. Its IUPAC name is [(2Z)-2-(3-benzyl-4-oxo-2-sulfanylidene-1,3-oxazolidin-5-ylidene)-1,3-benzothiazol-3-yl]methanesulfonic acid.
| Compound Name | [(2Z)-2-(3-benzyl-4-oxo-2-sulfanylidene-1,3-oxazolidin-5-ylidene)-1,3-benzothiazol-3-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 59937892 |
| Molecular Formula | C18H14N2O5S3 |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.01 |
| IUPAC Name | [(2Z)-2-(3-benzyl-4-oxo-2-sulfanylidene-1,3-oxazolidin-5-ylidene)-1,3-benzothiazol-3-yl]methanesulfonic acid |
| SMILES | O=C1/C(=C2/Sc3ccccc3N2CS(=O)(=O)O)OC(=S)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H14N2O5S3/c21-16-15(25-18(26)19(16)10-12-6-2-1-3-7-12)17-20(11-28(22,23)24)13-8-4-5-9-14(13)27-17/h1-9H,10-11H2,(H,22,23,24)/b17-15- |
| InChIKey | HFIWXMMMCXZFFJ-ICFOKQHNSA-N |
| XLogP | 2.96 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|