About 5-fluoro-2,4,6-trimethyloxan-3-amine
5-fluoro-2,4,6-trimethyloxan-3-amine (PubChem CID 59938457) has the molecular formula C8H16FNO
and a molecular weight of 161.22 g/mol. Its IUPAC name is 5-fluoro-2,4,6-trimethyloxan-3-amine.
Molecular Properties
| Compound Name | 5-fluoro-2,4,6-trimethyloxan-3-amine |
| PubChem CID | 59938457 |
| Molecular Formula | C8H16FNO |
| Molecular Weight | 161.22 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 5-fluoro-2,4,6-trimethyloxan-3-amine |
| SMILES | CC1OC(C)C(F)C(C)C1N |
| InChI | InChI=1S/C8H16FNO/c1-4-7(9)5(2)11-6(3)8(4)10/h4-8H,10H2,1-3H3 |
| InChIKey | VNMRZJNTGJKLRW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.22 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-2,4,6-trimethyloxan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2,4,6-trimethyloxan-3-amine?
The IUPAC name of 5-fluoro-2,4,6-trimethyloxan-3-amine (CID 59938457) is 5-fluoro-2,4,6-trimethyloxan-3-amine.
What is the SMILES notation for 5-fluoro-2,4,6-trimethyloxan-3-amine?
The canonical SMILES for 5-fluoro-2,4,6-trimethyloxan-3-amine is CC1OC(C)C(F)C(C)C1N.
What is the InChIKey of 5-fluoro-2,4,6-trimethyloxan-3-amine?
The InChIKey is VNMRZJNTGJKLRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16FNO/c1-4-7(9)5(2)11-6(3)8(4)10/h4-8H,10H2,1-3H3.
What are the key properties of 5-fluoro-2,4,6-trimethyloxan-3-amine?
5-fluoro-2,4,6-trimethyloxan-3-amine has a molecular weight of 161.22 g/mol, XLogP of 1.10, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2,4,6-trimethyloxan-3-amine is sourced from PubChem (CID 59938457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).