C11H16F2O — CID 59938786
1-[difluoro(methoxy)methyl]-4-[(E)-prop-1-enyl]cyclohexene (PubChem CID 59938786) has the molecular formula C11H16F2O and a molecular weight of 202.24 g/mol. Its IUPAC name is 1-[difluoro(methoxy)methyl]-4-[(E)-prop-1-enyl]cyclohexene.
| Compound Name | 1-[difluoro(methoxy)methyl]-4-[(E)-prop-1-enyl]cyclohexene |
|---|---|
| PubChem CID | 59938786 |
| Molecular Formula | C11H16F2O |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 1-[difluoro(methoxy)methyl]-4-[(E)-prop-1-enyl]cyclohexene |
| SMILES | C/C=C/C1CC=C(C(F)(F)OC)CC1 |
| InChI | InChI=1S/C11H16F2O/c1-3-4-9-5-7-10(8-6-9)11(12,13)14-2/h3-4,7,9H,5-6,8H2,1-2H3/b4-3+ |
| InChIKey | UHZXKTWBFQNUIY-ONEGZZNKSA-N |
| XLogP | 3.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|