About 2-methyl-6-(2-methyl-6-propan-2-ylphenyl)imino-8-nitroindolo[2,1-b]quinazolin-12-one
2-methyl-6-(2-methyl-6-propan-2-ylphenyl)imino-8-nitroindolo[2,1-b]quinazolin-12-one (PubChem CID 59938902) has the molecular formula C26H22N4O3
and a molecular weight of 438.49 g/mol. Its IUPAC name is 2-methyl-6-(2-methyl-6-propan-2-ylphenyl)imino-8-nitroindolo[2,1-b]quinazolin-12-one.
Molecular Properties
| Compound Name | 2-methyl-6-(2-methyl-6-propan-2-ylphenyl)imino-8-nitroindolo[2,1-b]quinazolin-12-one |
| PubChem CID | 59938902 |
| Molecular Formula | C26H22N4O3 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 2-methyl-6-(2-methyl-6-propan-2-ylphenyl)imino-8-nitroindolo[2,1-b]quinazolin-12-one |
| SMILES | Cc1ccc2nc3n(c(=O)c2c1)-c1ccc([N+](=O)[O-])cc1/C3=N/c1c(C)cccc1C(C)C |
| InChI | InChI=1S/C26H22N4O3/c1-14(2)18-7-5-6-16(4)23(18)28-24-20-13-17(30(32)33)9-11-22(20)29-25(24)27-21-10-8-15(3)12-19(21)26(29)31/h5-14H,1-4H3/b28-24- |
| InChIKey | LDUANKYYWRDYEY-COOPMVRXSA-N |
| XLogP | 5.52 |
| TPSA | 90.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-6-(2-methyl-6-propan-2-ylphenyl)imino-8-nitroindolo[2,1-b]quinazolin-12-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-(2-methyl-6-propan-2-ylphenyl)imino-8-nitroindolo[2,1-b]quinazolin-12-one?
The IUPAC name of 2-methyl-6-(2-methyl-6-propan-2-ylphenyl)imino-8-nitroindolo[2,1-b]quinazolin-12-one (CID 59938902) is 2-methyl-6-(2-methyl-6-propan-2-ylphenyl)imino-8-nitroindolo[2,1-b]quinazolin-12-one.
What is the SMILES notation for 2-methyl-6-(2-methyl-6-propan-2-ylphenyl)imino-8-nitroindolo[2,1-b]quinazolin-12-one?
The canonical SMILES for 2-methyl-6-(2-methyl-6-propan-2-ylphenyl)imino-8-nitroindolo[2,1-b]quinazolin-12-one is Cc1ccc2nc3n(c(=O)c2c1)-c1ccc([N+](=O)[O-])cc1/C3=N/c1c(C)cccc1C(C)C.
What is the InChIKey of 2-methyl-6-(2-methyl-6-propan-2-ylphenyl)imino-8-nitroindolo[2,1-b]quinazolin-12-one?
The InChIKey is LDUANKYYWRDYEY-COOPMVRXSA-N. The full InChI is InChI=1S/C26H22N4O3/c1-14(2)18-7-5-6-16(4)23(18)28-24-20-13-17(30(32)33)9-11-22(20)29-25(24)27-21-10-8-15(3)12-19(21)26(29)31/h5-14H,1-4H3/b28-24-.
What are the key properties of 2-methyl-6-(2-methyl-6-propan-2-ylphenyl)imino-8-nitroindolo[2,1-b]quinazolin-12-one?
2-methyl-6-(2-methyl-6-propan-2-ylphenyl)imino-8-nitroindolo[2,1-b]quinazolin-12-one has a molecular weight of 438.49 g/mol, XLogP of 5.52, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-(2-methyl-6-propan-2-ylphenyl)imino-8-nitroindolo[2,1-b]quinazolin-12-one is sourced from PubChem (CID 59938902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).