C9H11N3O2S — CID 59939151
N-(3-cyano-4,6-dimethyl-2-pyridinyl)methanesulfonamide (PubChem CID 59939151) has the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. Its IUPAC name is N-(3-cyano-4,6-dimethyl-2-pyridinyl)methanesulfonamide.
| Compound Name | N-(3-cyano-4,6-dimethyl-2-pyridinyl)methanesulfonamide |
|---|---|
| PubChem CID | 59939151 |
| Molecular Formula | C9H11N3O2S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | N-(3-cyano-4,6-dimethyl-2-pyridinyl)methanesulfonamide |
| SMILES | Cc1cc(C)c(C#N)c(NS(C)(=O)=O)n1 |
| InChI | InChI=1S/C9H11N3O2S/c1-6-4-7(2)11-9(8(6)5-10)12-15(3,13)14/h4H,1-3H3,(H,11,12) |
| InChIKey | FXNOVANXEKOMJF-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |