About pyridazin-3-yl methanesulfinate
pyridazin-3-yl methanesulfinate (PubChem CID 59940021) has the molecular formula C5H6N2O2S
and a molecular weight of 158.18 g/mol. Its IUPAC name is pyridazin-3-yl methanesulfinate.
Molecular Properties
| Compound Name | pyridazin-3-yl methanesulfinate |
| PubChem CID | 59940021 |
| Molecular Formula | C5H6N2O2S |
| Molecular Weight | 158.18 g/mol |
| Exact Mass | 158.01 |
| IUPAC Name | pyridazin-3-yl methanesulfinate |
| SMILES | CS(=O)Oc1cccnn1 |
| InChI | InChI=1S/C5H6N2O2S/c1-10(8)9-5-3-2-4-6-7-5/h2-4H,1H3 |
| InChIKey | KRRLAHRGFPRNAC-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.18 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyridazin-3-yl methanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridazin-3-yl methanesulfinate?
The IUPAC name of pyridazin-3-yl methanesulfinate (CID 59940021) is pyridazin-3-yl methanesulfinate.
What is the SMILES notation for pyridazin-3-yl methanesulfinate?
The canonical SMILES for pyridazin-3-yl methanesulfinate is CS(=O)Oc1cccnn1.
What is the InChIKey of pyridazin-3-yl methanesulfinate?
The InChIKey is KRRLAHRGFPRNAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O2S/c1-10(8)9-5-3-2-4-6-7-5/h2-4H,1H3.
What are the key properties of pyridazin-3-yl methanesulfinate?
pyridazin-3-yl methanesulfinate has a molecular weight of 158.18 g/mol, XLogP of 0.15, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridazin-3-yl methanesulfinate is sourced from PubChem (CID 59940021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).