About CID 59940150
CID 59940150 (PubChem CID 59940150) has the molecular formula C20H27F
and a molecular weight of 286.43 g/mol.
Molecular Properties
| Compound Name | CID 59940150 |
| PubChem CID | 59940150 |
| Molecular Formula | C20H27F |
| Molecular Weight | 286.43 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | — |
| SMILES | C[C]1CCC([C]2CCC(c3ccc(C)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C20H27F/c1-14-3-6-16(7-4-14)17-9-11-18(12-10-17)19-8-5-15(2)20(21)13-19/h5,8,13,16,18H,3-4,6-7,9-12H2,1-2H3 |
| InChIKey | YWFQSAZVVUBMPU-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.43 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 59940150 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59940150?
The IUPAC name of CID 59940150 (CID 59940150) is not available.
What is the SMILES notation for CID 59940150?
The canonical SMILES for CID 59940150 is C[C]1CCC([C]2CCC(c3ccc(C)c(F)c3)CC2)CC1.
What is the InChIKey of CID 59940150?
The InChIKey is YWFQSAZVVUBMPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27F/c1-14-3-6-16(7-4-14)17-9-11-18(12-10-17)19-8-5-15(2)20(21)13-19/h5,8,13,16,18H,3-4,6-7,9-12H2,1-2H3.
What are the key properties of CID 59940150?
CID 59940150 has a molecular weight of 286.43 g/mol, XLogP of 6.15, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59940150 is sourced from PubChem (CID 59940150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).