C22H36O4Si — CID 59941497
[(E)-but-2-enyl] (Z)-7-[3-[tert-butyl(dimethyl)silyl]oxy-5-oxocyclopenten-1-yl]hept-5-enoate (PubChem CID 59941497) has the molecular formula C22H36O4Si and a molecular weight of 392.61 g/mol. Its IUPAC name is [(E)-but-2-enyl] (Z)-7-[3-[tert-butyl(dimethyl)silyl]oxy-5-oxocyclopenten-1-yl]hept-5-enoate.
| Compound Name | [(E)-but-2-enyl] (Z)-7-[3-[tert-butyl(dimethyl)silyl]oxy-5-oxocyclopenten-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 59941497 |
| Molecular Formula | C22H36O4Si |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | [(E)-but-2-enyl] (Z)-7-[3-[tert-butyl(dimethyl)silyl]oxy-5-oxocyclopenten-1-yl]hept-5-enoate |
| SMILES | C/C=C/COC(=O)CCC/C=C\CC1=CC(O[Si](C)(C)C(C)(C)C)CC1=O |
| InChI | InChI=1S/C22H36O4Si/c1-7-8-15-25-21(24)14-12-10-9-11-13-18-16-19(17-20(18)23)26-27(5,6)22(2,3)4/h7-9,11,16,19H,10,12-15,17H2,1-6H3/b8-7+,11-9- |
| InChIKey | KEIUSJATSXIVNX-OHFYBLQUSA-N |
| XLogP | 5.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|