About CID 59941654
CID 59941654 (PubChem CID 59941654) has the molecular formula C45H67O14
and a molecular weight of 832.02 g/mol.
Molecular Properties
| Compound Name | CID 59941654 |
| PubChem CID | 59941654 |
| Molecular Formula | C45H67O14 |
| Molecular Weight | 832.02 g/mol |
| Exact Mass | 831.45 |
| IUPAC Name | — |
| SMILES | COC1CC(OC2C(C)OC(OC3/C(C)=C/CC4CC(CC5(C[CH]C(C)C(C)O5)O4)OC(=O)C4C=C(C)C(O)C5OC/C(=C\C=C\C3C)C45O)CC2OC)OC(C)C1O |
| InChI | InChI=1S/C45H67O14/c1-23-15-16-44(58-27(23)5)21-32-18-31(59-44)14-13-25(3)40(24(2)11-10-12-30-22-52-42-38(46)26(4)17-33(43(48)55-32)45(30,42)49)56-37-20-35(51-9)41(29(7)54-37)57-36-19-34(50-8)39(47)28(6)53-36/h10-13,15,17,23-24,27-29,31-42,46-47,49H,14,16,18-22H2,1-9H3/b11-10+,25-13+,30-12+ |
| InChIKey | PHAASOHYXHAIEW-AHNATSIKSA-N |
| XLogP | 4.39 |
| TPSA | 170.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 832.02 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 59941654 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59941654?
The IUPAC name of CID 59941654 (CID 59941654) is not available.
What is the SMILES notation for CID 59941654?
The canonical SMILES for CID 59941654 is COC1CC(OC2C(C)OC(OC3/C(C)=C/CC4CC(CC5(C[CH]C(C)C(C)O5)O4)OC(=O)C4C=C(C)C(O)C5OC/C(=C\C=C\C3C)C45O)CC2OC)OC(C)C1O.
What is the InChIKey of CID 59941654?
The InChIKey is PHAASOHYXHAIEW-AHNATSIKSA-N. The full InChI is InChI=1S/C45H67O14/c1-23-15-16-44(58-27(23)5)21-32-18-31(59-44)14-13-25(3)40(24(2)11-10-12-30-22-52-42-38(46)26(4)17-33(43(48)55-32)45(30,42)49)56-37-20-35(51-9)41(29(7)54-37)57-36-19-34(50-8)39(47)28(6)53-36/h10-13,15,17,23-24,27-29,31-42,46-47,49H,14,16,18-22H2,1-9H3/b11-10+,25-13+,30-12+.
What are the key properties of CID 59941654?
CID 59941654 has a molecular weight of 832.02 g/mol, XLogP of 4.39, 6 rotatable bonds, 3 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59941654 is sourced from PubChem (CID 59941654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).