C9H16NO2W- — CID 59942404
N,N,2,3,3-pentamethyl-4-oxobutanamide;tungsten (PubChem CID 59942404) has the molecular formula C9H16NO2W- and a molecular weight of 354.07 g/mol. Its IUPAC name is N,N,2,3,3-pentamethyl-4-oxobutanamide;tungsten.
| Compound Name | N,N,2,3,3-pentamethyl-4-oxobutanamide;tungsten |
|---|---|
| PubChem CID | 59942404 |
| Molecular Formula | C9H16NO2W- |
| Molecular Weight | 354.07 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | N,N,2,3,3-pentamethyl-4-oxobutanamide;tungsten |
| SMILES | CC(C(=O)N(C)C)C(C)(C)[C-]=O.[W] |
| InChI | InChI=1S/C9H16NO2.W/c1-7(8(12)10(4)5)9(2,3)6-11;/h7H,1-5H3;/q-1; |
| InChIKey | FOXDBCDTRPXSAD-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.07 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|