About (Z)-1-(4-fluorophenyl)-3,3-dimethylbut-1-en-2-ol
(Z)-1-(4-fluorophenyl)-3,3-dimethylbut-1-en-2-ol (PubChem CID 59942455) has the molecular formula C12H15FO
and a molecular weight of 194.25 g/mol. Its IUPAC name is (Z)-1-(4-fluorophenyl)-3,3-dimethylbut-1-en-2-ol.
Molecular Properties
| Compound Name | (Z)-1-(4-fluorophenyl)-3,3-dimethylbut-1-en-2-ol |
| PubChem CID | 59942455 |
| Molecular Formula | C12H15FO |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | (Z)-1-(4-fluorophenyl)-3,3-dimethylbut-1-en-2-ol |
| SMILES | CC(C)(C)/C(O)=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C12H15FO/c1-12(2,3)11(14)8-9-4-6-10(13)7-5-9/h4-8,14H,1-3H3/b11-8- |
| InChIKey | PNYDLWZJYRKGST-FLIBITNWSA-N |
| XLogP | 3.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-(4-fluorophenyl)-3,3-dimethylbut-1-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-(4-fluorophenyl)-3,3-dimethylbut-1-en-2-ol?
The IUPAC name of (Z)-1-(4-fluorophenyl)-3,3-dimethylbut-1-en-2-ol (CID 59942455) is (Z)-1-(4-fluorophenyl)-3,3-dimethylbut-1-en-2-ol.
What is the SMILES notation for (Z)-1-(4-fluorophenyl)-3,3-dimethylbut-1-en-2-ol?
The canonical SMILES for (Z)-1-(4-fluorophenyl)-3,3-dimethylbut-1-en-2-ol is CC(C)(C)/C(O)=C/c1ccc(F)cc1.
What is the InChIKey of (Z)-1-(4-fluorophenyl)-3,3-dimethylbut-1-en-2-ol?
The InChIKey is PNYDLWZJYRKGST-FLIBITNWSA-N. The full InChI is InChI=1S/C12H15FO/c1-12(2,3)11(14)8-9-4-6-10(13)7-5-9/h4-8,14H,1-3H3/b11-8-.
What are the key properties of (Z)-1-(4-fluorophenyl)-3,3-dimethylbut-1-en-2-ol?
(Z)-1-(4-fluorophenyl)-3,3-dimethylbut-1-en-2-ol has a molecular weight of 194.25 g/mol, XLogP of 3.77, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-(4-fluorophenyl)-3,3-dimethylbut-1-en-2-ol is sourced from PubChem (CID 59942455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).