C23H33AcF3O9S — CID 59942706
actinium;trifluoromethyl [(2S,10S)-1,4,15-trihydroxy-12-methoxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-9-yl] sulfite (PubChem CID 59942706) has the molecular formula C23H33AcF3O9S and a molecular weight of 769.57 g/mol. Its IUPAC name is actinium;trifluoromethyl [(2S,10S)-1,4,15-trihydroxy-12-methoxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-9-yl] sulfite.
| Compound Name | actinium;trifluoromethyl [(2S,10S)-1,4,15-trihydroxy-12-methoxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-9-yl] sulfite |
|---|---|
| PubChem CID | 59942706 |
| Molecular Formula | C23H33AcF3O9S |
| Molecular Weight | 769.57 g/mol |
| Exact Mass | 769.21 |
| IUPAC Name | actinium;trifluoromethyl [(2S,10S)-1,4,15-trihydroxy-12-methoxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-9-yl] sulfite |
| SMILES | COC1C(=O)[C@]2(C)C(OS(=O)OC(F)(F)F)CC3OCC3(O)C2[C@H](C)C2(O)CC(O)C(C)=C1C2(C)C.[Ac] |
| InChI | InChI=1S/C23H33F3O9S.Ac/c1-10-12(27)8-22(30)11(2)17-20(5,18(28)16(32-6)15(10)19(22,3)4)13(7-14-21(17,29)9-33-14)34-36(31)35-23(24,25)26;/h11-14,16-17,27,29-30H,7-9H2,1-6H3;/t11-,12?,13?,14?,16?,17?,20+,21?,22?,36?;/m0./s1 |
| InChIKey | NKWGVIHEWORAIS-WCXURRHQSA-N |
| XLogP | 1.72 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.57 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|