C10H19N3O4 — CID 59943050
2-acetamido-N-[2-(ethylamino)-2-oxoethyl]-N-(methoxymethyl)acetamide (PubChem CID 59943050) has the molecular formula C10H19N3O4 and a molecular weight of 245.28 g/mol. Its IUPAC name is 2-acetamido-N-[2-(ethylamino)-2-oxoethyl]-N-(methoxymethyl)acetamide.
| Compound Name | 2-acetamido-N-[2-(ethylamino)-2-oxoethyl]-N-(methoxymethyl)acetamide |
|---|---|
| PubChem CID | 59943050 |
| Molecular Formula | C10H19N3O4 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 2-acetamido-N-[2-(ethylamino)-2-oxoethyl]-N-(methoxymethyl)acetamide |
| SMILES | CCNC(=O)CN(COC)C(=O)CNC(C)=O |
| InChI | InChI=1S/C10H19N3O4/c1-4-11-9(15)6-13(7-17-3)10(16)5-12-8(2)14/h4-7H2,1-3H3,(H,11,15)(H,12,14) |
| InChIKey | YOZIZGFCQILXQU-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|