C16H27NO8 — CID 59943527
1-[3-[(2S)-3,4,5-trihydroxy-6-methyloxan-2-yl]propoxycarbonyl]piperidine-4-carboxylic acid (PubChem CID 59943527) has the molecular formula C16H27NO8 and a molecular weight of 361.39 g/mol. Its IUPAC name is 1-[3-[(2S)-3,4,5-trihydroxy-6-methyloxan-2-yl]propoxycarbonyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[3-[(2S)-3,4,5-trihydroxy-6-methyloxan-2-yl]propoxycarbonyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 59943527 |
| Molecular Formula | C16H27NO8 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 1-[3-[(2S)-3,4,5-trihydroxy-6-methyloxan-2-yl]propoxycarbonyl]piperidine-4-carboxylic acid |
| SMILES | CC1O[C@@H](CCCOC(=O)N2CCC(C(=O)O)CC2)C(O)C(O)C1O |
| InChI | InChI=1S/C16H27NO8/c1-9-12(18)14(20)13(19)11(25-9)3-2-8-24-16(23)17-6-4-10(5-7-17)15(21)22/h9-14,18-20H,2-8H2,1H3,(H,21,22)/t9?,11-,12?,13?,14?/m0/s1 |
| InChIKey | BSMDVHBHNPIAIU-NIBLHCRISA-N |
| XLogP | -0.43 |
| TPSA | 136.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|