C15H25F2O4P — CID 59944039
(4R)-4-(4,4-difluoro-3-hydroxyoctyl)-5-phosphanyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 59944039) has the molecular formula C15H25F2O4P and a molecular weight of 338.33 g/mol. Its IUPAC name is (4R)-4-(4,4-difluoro-3-hydroxyoctyl)-5-phosphanyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (4R)-4-(4,4-difluoro-3-hydroxyoctyl)-5-phosphanyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 59944039 |
| Molecular Formula | C15H25F2O4P |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (4R)-4-(4,4-difluoro-3-hydroxyoctyl)-5-phosphanyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCCC(F)(F)C(O)CC[C@H]1C(OP)CC2OC(=O)CC21 |
| InChI | InChI=1S/C15H25F2O4P/c1-2-3-6-15(16,17)13(18)5-4-9-10-7-14(19)20-11(10)8-12(9)21-22/h9-13,18H,2-8,22H2,1H3/t9-,10?,11?,12?,13?/m1/s1 |
| InChIKey | JXUSEHSKWPQLND-HIVKSXORSA-N |
| XLogP | 3.08 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|