C15H29N2+ — CID 59944074
1-methyl-2-[(E)-undec-8-enyl]-4,5-dihydro-1H-imidazol-1-ium (PubChem CID 59944074) has the molecular formula C15H29N2+ and a molecular weight of 237.41 g/mol. Its IUPAC name is 1-methyl-2-[(E)-undec-8-enyl]-4,5-dihydro-1H-imidazol-1-ium.
| Compound Name | 1-methyl-2-[(E)-undec-8-enyl]-4,5-dihydro-1H-imidazol-1-ium |
|---|---|
| PubChem CID | 59944074 |
| Molecular Formula | C15H29N2+ |
| Molecular Weight | 237.41 g/mol |
| Exact Mass | 237.23 |
| IUPAC Name | 1-methyl-2-[(E)-undec-8-enyl]-4,5-dihydro-1H-imidazol-1-ium |
| SMILES | CC/C=C/CCCCCCCC1=NCC[NH+]1C |
| InChI | InChI=1S/C15H28N2/c1-3-4-5-6-7-8-9-10-11-12-15-16-13-14-17(15)2/h4-5H,3,6-14H2,1-2H3/p+1/b5-4+ |
| InChIKey | DROHQKNFHNEDDW-SNAWJCMRSA-O |
| XLogP | 2.61 |
| TPSA | 16.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|