C10H12N2Se — CID 59944182
2,3,5,7-tetramethylselenopheno[3,4-b]pyrazine (PubChem CID 59944182) has the molecular formula C10H12N2Se and a molecular weight of 239.18 g/mol. Its IUPAC name is 2,3,5,7-tetramethylselenopheno[3,4-b]pyrazine.
| Compound Name | 2,3,5,7-tetramethylselenopheno[3,4-b]pyrazine |
|---|---|
| PubChem CID | 59944182 |
| Molecular Formula | C10H12N2Se |
| Molecular Weight | 239.18 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | 2,3,5,7-tetramethylselenopheno[3,4-b]pyrazine |
| SMILES | Cc1nc2c(C)[se]c(C)c2nc1C |
| InChI | InChI=1S/C10H12N2Se/c1-5-6(2)12-10-8(4)13-7(3)9(10)11-5/h1-4H3 |
| InChIKey | PBPSYABRNCXYTR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.18 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|