C13H21B — CID 59944476
dimethyl-(2,3,4,5,6-pentamethylphenyl)borane (PubChem CID 59944476) has the molecular formula C13H21B and a molecular weight of 188.12 g/mol. Its IUPAC name is dimethyl-(2,3,4,5,6-pentamethylphenyl)borane.
| Compound Name | dimethyl-(2,3,4,5,6-pentamethylphenyl)borane |
|---|---|
| PubChem CID | 59944476 |
| Molecular Formula | C13H21B |
| Molecular Weight | 188.12 g/mol |
| Exact Mass | 188.17 |
| IUPAC Name | dimethyl-(2,3,4,5,6-pentamethylphenyl)borane |
| SMILES | CB(C)c1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C13H21B/c1-8-9(2)11(4)13(14(6)7)12(5)10(8)3/h1-7H3 |
| InChIKey | WNQWGNUSHNBKNR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.12 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|