C22H37F17O4Si4 — CID 59944632
3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)-methylsilyl]oxy-dimethylsilyl]propan-1-ol (PubChem CID 59944632) has the molecular formula C22H37F17O4Si4 and a molecular weight of 800.84 g/mol. Its IUPAC name is 3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)-methylsilyl]oxy-dimethylsilyl]propan-1-ol.
| Compound Name | 3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)-methylsilyl]oxy-dimethylsilyl]propan-1-ol |
|---|---|
| PubChem CID | 59944632 |
| Molecular Formula | C22H37F17O4Si4 |
| Molecular Weight | 800.84 g/mol |
| Exact Mass | 800.15 |
| IUPAC Name | 3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)-methylsilyl]oxy-dimethylsilyl]propan-1-ol |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)O[Si](C)(C)CCCO |
| InChI | InChI=1S/C22H37F17O4Si4/c1-44(2,3)41-46(6,7)43-47(8,42-45(4,5)13-10-12-40)14-9-11-15(23,24)16(25,26)17(27,28)18(29,30)19(31,32)20(33,34)21(35,36)22(37,38)39/h40H,9-14H2,1-8H3 |
| InChIKey | JWKFICIJKWSLSI-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.84 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|