C21H35F17O4Si4 — CID 59944634
3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-methylsilyl]oxy-dimethylsilyl]propan-1-ol (PubChem CID 59944634) has the molecular formula C21H35F17O4Si4 and a molecular weight of 786.82 g/mol. Its IUPAC name is 3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-methylsilyl]oxy-dimethylsilyl]propan-1-ol.
| Compound Name | 3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-methylsilyl]oxy-dimethylsilyl]propan-1-ol |
|---|---|
| PubChem CID | 59944634 |
| Molecular Formula | C21H35F17O4Si4 |
| Molecular Weight | 786.82 g/mol |
| Exact Mass | 786.13 |
| IUPAC Name | 3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-methylsilyl]oxy-dimethylsilyl]propan-1-ol |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)O[Si](C)(C)CCCO |
| InChI | InChI=1S/C21H35F17O4Si4/c1-43(2,3)40-45(6,7)42-46(8,41-44(4,5)12-9-11-39)13-10-14(22,23)15(24,25)16(26,27)17(28,29)18(30,31)19(32,33)20(34,35)21(36,37)38/h39H,9-13H2,1-8H3 |
| InChIKey | KKIKUCWVMMJZHE-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.82 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|