C25H43F17O5Si4 — CID 59944639
3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-[3-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)propyl]-methylsilyl]oxy-dimethylsilyl]propan-1-ol (PubChem CID 59944639) has the molecular formula C25H43F17O5Si4 and a molecular weight of 858.92 g/mol. Its IUPAC name is 3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-[3-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)propyl]-methylsilyl]oxy-dimethylsilyl]propan-1-ol.
| Compound Name | 3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-[3-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)propyl]-methylsilyl]oxy-dimethylsilyl]propan-1-ol |
|---|---|
| PubChem CID | 59944639 |
| Molecular Formula | C25H43F17O5Si4 |
| Molecular Weight | 858.92 g/mol |
| Exact Mass | 858.19 |
| IUPAC Name | 3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-[3-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecoxy)propyl]-methylsilyl]oxy-dimethylsilyl]propan-1-ol |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(CCCOCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)O[Si](C)(C)CCCO |
| InChI | InChI=1S/C25H43F17O5Si4/c1-48(2,3)45-50(6,7)47-51(8,46-49(4,5)16-10-13-43)17-11-15-44-14-9-12-18(26,27)19(28,29)20(30,31)21(32,33)22(34,35)23(36,37)24(38,39)25(40,41)42/h43H,9-17H2,1-8H3 |
| InChIKey | VKDNDLODPIWTDR-UHFFFAOYSA-N |
| XLogP | 10.43 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.92 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|