C20H41F9O5Si4 — CID 59944640
3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-[3-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)propyl]silyl]oxy-dimethylsilyl]propan-1-ol (PubChem CID 59944640) has the molecular formula C20H41F9O5Si4 and a molecular weight of 644.87 g/mol. Its IUPAC name is 3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-[3-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)propyl]silyl]oxy-dimethylsilyl]propan-1-ol.
| Compound Name | 3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-[3-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)propyl]silyl]oxy-dimethylsilyl]propan-1-ol |
|---|---|
| PubChem CID | 59944640 |
| Molecular Formula | C20H41F9O5Si4 |
| Molecular Weight | 644.87 g/mol |
| Exact Mass | 644.19 |
| IUPAC Name | 3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-[3-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)propyl]silyl]oxy-dimethylsilyl]propan-1-ol |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(CCCOCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)O[Si](C)(C)CCCO |
| InChI | InChI=1S/C20H41F9O5Si4/c1-35(2,3)32-37(6,7)34-38(8,33-36(4,5)15-9-12-30)16-10-13-31-14-11-17(21,22)18(23,24)19(25,26)20(27,28)29/h30H,9-16H2,1-8H3 |
| InChIKey | VXNMAVXIGAGTPQ-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.87 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|