C21H41F11O5Si4 — CID 59944641
3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-[3-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptoxy)propyl]silyl]oxy-dimethylsilyl]propan-1-ol (PubChem CID 59944641) has the molecular formula C21H41F11O5Si4 and a molecular weight of 694.88 g/mol. Its IUPAC name is 3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-[3-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptoxy)propyl]silyl]oxy-dimethylsilyl]propan-1-ol.
| Compound Name | 3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-[3-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptoxy)propyl]silyl]oxy-dimethylsilyl]propan-1-ol |
|---|---|
| PubChem CID | 59944641 |
| Molecular Formula | C21H41F11O5Si4 |
| Molecular Weight | 694.88 g/mol |
| Exact Mass | 694.19 |
| IUPAC Name | 3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-[3-(3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptoxy)propyl]silyl]oxy-dimethylsilyl]propan-1-ol |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(CCCOCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)O[Si](C)(C)CCCO |
| InChI | InChI=1S/C21H41F11O5Si4/c1-38(2,3)35-40(6,7)37-41(8,36-39(4,5)15-9-12-33)16-10-13-34-14-11-17(22,23)18(24,25)19(26,27)20(28,29)21(30,31)32/h33H,9-16H2,1-8H3 |
| InChIKey | OZMSINXHORUZKJ-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.88 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|