C21H41F11O4Si4 — CID 59944644
3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-(6,6,7,7,8,8,9,9,10,10,10-undecafluorodecyl)silyl]oxy-dimethylsilyl]propan-1-ol (PubChem CID 59944644) has the molecular formula C21H41F11O4Si4 and a molecular weight of 678.88 g/mol. Its IUPAC name is 3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-(6,6,7,7,8,8,9,9,10,10,10-undecafluorodecyl)silyl]oxy-dimethylsilyl]propan-1-ol.
| Compound Name | 3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-(6,6,7,7,8,8,9,9,10,10,10-undecafluorodecyl)silyl]oxy-dimethylsilyl]propan-1-ol |
|---|---|
| PubChem CID | 59944644 |
| Molecular Formula | C21H41F11O4Si4 |
| Molecular Weight | 678.88 g/mol |
| Exact Mass | 678.19 |
| IUPAC Name | 3-[[[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-(6,6,7,7,8,8,9,9,10,10,10-undecafluorodecyl)silyl]oxy-dimethylsilyl]propan-1-ol |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(CCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)O[Si](C)(C)CCCO |
| InChI | InChI=1S/C21H41F11O4Si4/c1-37(2,3)34-39(6,7)36-40(8,35-38(4,5)15-12-14-33)16-11-9-10-13-17(22,23)18(24,25)19(26,27)20(28,29)21(30,31)32/h33H,9-16H2,1-8H3 |
| InChIKey | RMEMXWRTZRHCKD-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.88 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|