C19H19N5Na2O7S3 — CID 59944752
disodium;3-[[2-acetamido-4-[methyl(3-sulfonatopropyl)amino]phenyl]diazenyl]-2,1-benzothiazole-5-sulfonate (PubChem CID 59944752) has the molecular formula C19H19N5Na2O7S3 and a molecular weight of 571.57 g/mol. Its IUPAC name is disodium;3-[[2-acetamido-4-[methyl(3-sulfonatopropyl)amino]phenyl]diazenyl]-2,1-benzothiazole-5-sulfonate.
| Compound Name | disodium;3-[[2-acetamido-4-[methyl(3-sulfonatopropyl)amino]phenyl]diazenyl]-2,1-benzothiazole-5-sulfonate |
|---|---|
| PubChem CID | 59944752 |
| Molecular Formula | C19H19N5Na2O7S3 |
| Molecular Weight | 571.57 g/mol |
| Exact Mass | 571.02 |
| IUPAC Name | disodium;3-[[2-acetamido-4-[methyl(3-sulfonatopropyl)amino]phenyl]diazenyl]-2,1-benzothiazole-5-sulfonate |
| SMILES | CC(=O)Nc1cc(N(C)CCCS(=O)(=O)[O-])ccc1/N=N/c1snc2ccc(S(=O)(=O)[O-])cc12.[Na+].[Na+] |
| InChI | InChI=1S/C19H21N5O7S3.2Na/c1-12(25)20-18-10-13(24(2)8-3-9-33(26,27)28)4-6-17(18)21-22-19-15-11-14(34(29,30)31)5-7-16(15)23-32-19;;/h4-7,10-11H,3,8-9H2,1-2H3,(H,20,25)(H,26,27,28)(H,29,30,31);;/q;2*+1/p-2/b22-21+;; |
| InChIKey | WQTNJTPUUMBFGC-ZPZFBZIMSA-L |
| XLogP | -3.05 |
| TPSA | 184.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.57 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|