About 5,6-dimethyl-3,4-dihydro-2H-1,4-oxazine
5,6-dimethyl-3,4-dihydro-2H-1,4-oxazine (PubChem CID 59944790) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol. Its IUPAC name is 5,6-dimethyl-3,4-dihydro-2H-1,4-oxazine.
Molecular Properties
| Compound Name | 5,6-dimethyl-3,4-dihydro-2H-1,4-oxazine |
| PubChem CID | 59944790 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | 5,6-dimethyl-3,4-dihydro-2H-1,4-oxazine |
| SMILES | CC1=C(C)OCCN1 |
| InChI | InChI=1S/C6H11NO/c1-5-6(2)8-4-3-7-5/h7H,3-4H2,1-2H3 |
| InChIKey | LZVUYBUXFUFBFA-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-dimethyl-3,4-dihydro-2H-1,4-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-3,4-dihydro-2H-1,4-oxazine?
The IUPAC name of 5,6-dimethyl-3,4-dihydro-2H-1,4-oxazine (CID 59944790) is 5,6-dimethyl-3,4-dihydro-2H-1,4-oxazine.
What is the SMILES notation for 5,6-dimethyl-3,4-dihydro-2H-1,4-oxazine?
The canonical SMILES for 5,6-dimethyl-3,4-dihydro-2H-1,4-oxazine is CC1=C(C)OCCN1.
What is the InChIKey of 5,6-dimethyl-3,4-dihydro-2H-1,4-oxazine?
The InChIKey is LZVUYBUXFUFBFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO/c1-5-6(2)8-4-3-7-5/h7H,3-4H2,1-2H3.
What are the key properties of 5,6-dimethyl-3,4-dihydro-2H-1,4-oxazine?
5,6-dimethyl-3,4-dihydro-2H-1,4-oxazine has a molecular weight of 113.16 g/mol, XLogP of 0.86, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-3,4-dihydro-2H-1,4-oxazine is sourced from PubChem (CID 59944790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).