C23H36O12 — CID 59944808
1-O,2-O,3-O-trimethyl 4-O-[2-methyl-2-(9-methyl-2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl)propyl] butane-1,2,3,4-tetracarboxylate (PubChem CID 59944808) has the molecular formula C23H36O12 and a molecular weight of 504.53 g/mol. Its IUPAC name is 1-O,2-O,3-O-trimethyl 4-O-[2-methyl-2-(9-methyl-2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl)propyl] butane-1,2,3,4-tetracarboxylate.
| Compound Name | 1-O,2-O,3-O-trimethyl 4-O-[2-methyl-2-(9-methyl-2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl)propyl] butane-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 59944808 |
| Molecular Formula | C23H36O12 |
| Molecular Weight | 504.53 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 1-O,2-O,3-O-trimethyl 4-O-[2-methyl-2-(9-methyl-2,4,8,10-tetraoxaspiro[5.5]undecan-3-yl)propyl] butane-1,2,3,4-tetracarboxylate |
| SMILES | COC(=O)CC(C(=O)OC)C(CC(=O)OCC(C)(C)C1OCC2(COC(C)OC2)CO1)C(=O)OC |
| InChI | InChI=1S/C23H36O12/c1-14-31-10-23(11-32-14)12-34-21(35-13-23)22(2,3)9-33-18(25)8-16(20(27)30-6)15(19(26)29-5)7-17(24)28-4/h14-16,21H,7-13H2,1-6H3 |
| InChIKey | BQTSHLBZRGHDJG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.53 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|