About (E)-6-[ethyl(methyl)amino]hex-3-ene-1,5-diol
(E)-6-[ethyl(methyl)amino]hex-3-ene-1,5-diol (PubChem CID 59944818) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is (E)-6-[ethyl(methyl)amino]hex-3-ene-1,5-diol.
Molecular Properties
| Compound Name | (E)-6-[ethyl(methyl)amino]hex-3-ene-1,5-diol |
| PubChem CID | 59944818 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | (E)-6-[ethyl(methyl)amino]hex-3-ene-1,5-diol |
| SMILES | CCN(C)CC(O)/C=C/CCO |
| InChI | InChI=1S/C9H19NO2/c1-3-10(2)8-9(12)6-4-5-7-11/h4,6,9,11-12H,3,5,7-8H2,1-2H3/b6-4+ |
| InChIKey | YMSPDQLHNSSBIB-GQCTYLIASA-N |
| XLogP | 0.24 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-6-[ethyl(methyl)amino]hex-3-ene-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-6-[ethyl(methyl)amino]hex-3-ene-1,5-diol?
The IUPAC name of (E)-6-[ethyl(methyl)amino]hex-3-ene-1,5-diol (CID 59944818) is (E)-6-[ethyl(methyl)amino]hex-3-ene-1,5-diol.
What is the SMILES notation for (E)-6-[ethyl(methyl)amino]hex-3-ene-1,5-diol?
The canonical SMILES for (E)-6-[ethyl(methyl)amino]hex-3-ene-1,5-diol is CCN(C)CC(O)/C=C/CCO.
What is the InChIKey of (E)-6-[ethyl(methyl)amino]hex-3-ene-1,5-diol?
The InChIKey is YMSPDQLHNSSBIB-GQCTYLIASA-N. The full InChI is InChI=1S/C9H19NO2/c1-3-10(2)8-9(12)6-4-5-7-11/h4,6,9,11-12H,3,5,7-8H2,1-2H3/b6-4+.
What are the key properties of (E)-6-[ethyl(methyl)amino]hex-3-ene-1,5-diol?
(E)-6-[ethyl(methyl)amino]hex-3-ene-1,5-diol has a molecular weight of 173.26 g/mol, XLogP of 0.24, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-6-[ethyl(methyl)amino]hex-3-ene-1,5-diol is sourced from PubChem (CID 59944818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).