C18H15F5N2O — CID 59945010
2-tert-butyl-6-methyl-4-[[(2,3,4,5,6-pentafluorophenyl)diazenyl]methylidene]cyclohexa-2,5-dien-1-one (PubChem CID 59945010) has the molecular formula C18H15F5N2O and a molecular weight of 370.32 g/mol. Its IUPAC name is 2-tert-butyl-6-methyl-4-[[(2,3,4,5,6-pentafluorophenyl)diazenyl]methylidene]cyclohexa-2,5-dien-1-one.
| Compound Name | 2-tert-butyl-6-methyl-4-[[(2,3,4,5,6-pentafluorophenyl)diazenyl]methylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 59945010 |
| Molecular Formula | C18H15F5N2O |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 2-tert-butyl-6-methyl-4-[[(2,3,4,5,6-pentafluorophenyl)diazenyl]methylidene]cyclohexa-2,5-dien-1-one |
| SMILES | CC1=CC(=C/N=N/c2c(F)c(F)c(F)c(F)c2F)C=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C18H15F5N2O/c1-8-5-9(6-10(17(8)26)18(2,3)4)7-24-25-16-14(22)12(20)11(19)13(21)15(16)23/h5-7H,1-4H3/b9-7?,25-24+ |
| InChIKey | SJQPVSSCFKNTLH-BZAFDOIHSA-N |
| XLogP | 5.85 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|