About potassium N-phenylmethanimine
potassium N-phenylmethanimine (PubChem CID 59945797) has the molecular formula C7H5KN-
and a molecular weight of 142.22 g/mol. Its IUPAC name is potassium N-phenylmethanimine.
Molecular Properties
| Compound Name | potassium N-phenylmethanimine |
| PubChem CID | 59945797 |
| Molecular Formula | C7H5KN- |
| Molecular Weight | 142.22 g/mol |
| Exact Mass | 142.01 |
| IUPAC Name | potassium N-phenylmethanimine |
| SMILES | [H]/[C-]=N/c1[c-]cccc1.[K+] |
| InChI | InChI=1S/C7H5N.K/c1-8-7-5-3-2-4-6-7;/h1-5H;/q-2;+1 |
| InChIKey | BEBAQEAAMFYNBY-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.22 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze potassium N-phenylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium N-phenylmethanimine?
The IUPAC name of potassium N-phenylmethanimine (CID 59945797) is potassium N-phenylmethanimine.
What is the SMILES notation for potassium N-phenylmethanimine?
The canonical SMILES for potassium N-phenylmethanimine is [H]/[C-]=N/c1[c-]cccc1.[K+].
What is the InChIKey of potassium N-phenylmethanimine?
The InChIKey is BEBAQEAAMFYNBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N.K/c1-8-7-5-3-2-4-6-7;/h1-5H;/q-2;+1.
What are the key properties of potassium N-phenylmethanimine?
potassium N-phenylmethanimine has a molecular weight of 142.22 g/mol, XLogP of -1.30, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium N-phenylmethanimine is sourced from PubChem (CID 59945797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).