About 3-aminobutan-2-ylazanide;yttrium
3-aminobutan-2-ylazanide;yttrium (PubChem CID 59946259) has the molecular formula C4H11N2Y-
and a molecular weight of 176.05 g/mol. Its IUPAC name is 3-aminobutan-2-ylazanide;yttrium.
Molecular Properties
| Compound Name | 3-aminobutan-2-ylazanide;yttrium |
| PubChem CID | 59946259 |
| Molecular Formula | C4H11N2Y- |
| Molecular Weight | 176.05 g/mol |
| Exact Mass | 176.00 |
| IUPAC Name | 3-aminobutan-2-ylazanide;yttrium |
| SMILES | CC([NH-])C(C)N.[Y] |
| InChI | InChI=1S/C4H11N2.Y/c1-3(5)4(2)6;/h3-5H,6H2,1-2H3;/q-1; |
| InChIKey | VMYYKSXZAARILT-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.05 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-aminobutan-2-ylazanide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminobutan-2-ylazanide;yttrium?
The IUPAC name of 3-aminobutan-2-ylazanide;yttrium (CID 59946259) is 3-aminobutan-2-ylazanide;yttrium.
What is the SMILES notation for 3-aminobutan-2-ylazanide;yttrium?
The canonical SMILES for 3-aminobutan-2-ylazanide;yttrium is CC([NH-])C(C)N.[Y].
What is the InChIKey of 3-aminobutan-2-ylazanide;yttrium?
The InChIKey is VMYYKSXZAARILT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N2.Y/c1-3(5)4(2)6;/h3-5H,6H2,1-2H3;/q-1;.
What are the key properties of 3-aminobutan-2-ylazanide;yttrium?
3-aminobutan-2-ylazanide;yttrium has a molecular weight of 176.05 g/mol, XLogP of 0.77, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminobutan-2-ylazanide;yttrium is sourced from PubChem (CID 59946259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).