C12H15N3O3 — CID 59946266
2,3,4-trimethyl-9-nitro-2,3-dihydro-1H-1,4-benzodiazepin-5-one (PubChem CID 59946266) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is 2,3,4-trimethyl-9-nitro-2,3-dihydro-1H-1,4-benzodiazepin-5-one.
| Compound Name | 2,3,4-trimethyl-9-nitro-2,3-dihydro-1H-1,4-benzodiazepin-5-one |
|---|---|
| PubChem CID | 59946266 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 2,3,4-trimethyl-9-nitro-2,3-dihydro-1H-1,4-benzodiazepin-5-one |
| SMILES | CC1Nc2c(cccc2[N+](=O)[O-])C(=O)N(C)C1C |
| InChI | InChI=1S/C12H15N3O3/c1-7-8(2)14(3)12(16)9-5-4-6-10(15(17)18)11(9)13-7/h4-8,13H,1-3H3 |
| InChIKey | YAFCKTYPAQXJKK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|