About 3-propan-2-ylbenzene-1,2-diamine;tungsten
3-propan-2-ylbenzene-1,2-diamine;tungsten (PubChem CID 59946286) has the molecular formula C9H13N2W-
and a molecular weight of 333.06 g/mol. Its IUPAC name is 3-propan-2-ylbenzene-1,2-diamine;tungsten.
Molecular Properties
| Compound Name | 3-propan-2-ylbenzene-1,2-diamine;tungsten |
| PubChem CID | 59946286 |
| Molecular Formula | C9H13N2W- |
| Molecular Weight | 333.06 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 3-propan-2-ylbenzene-1,2-diamine;tungsten |
| SMILES | C[C-](C)c1cccc(N)c1N.[W] |
| InChI | InChI=1S/C9H13N2.W/c1-6(2)7-4-3-5-8(10)9(7)11;/h3-5H,10-11H2,1-2H3;/q-1; |
| InChIKey | JDMJWROTCYZQPL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.06 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-propan-2-ylbenzene-1,2-diamine;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-ylbenzene-1,2-diamine;tungsten?
The IUPAC name of 3-propan-2-ylbenzene-1,2-diamine;tungsten (CID 59946286) is 3-propan-2-ylbenzene-1,2-diamine;tungsten.
What is the SMILES notation for 3-propan-2-ylbenzene-1,2-diamine;tungsten?
The canonical SMILES for 3-propan-2-ylbenzene-1,2-diamine;tungsten is C[C-](C)c1cccc(N)c1N.[W].
What is the InChIKey of 3-propan-2-ylbenzene-1,2-diamine;tungsten?
The InChIKey is JDMJWROTCYZQPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N2.W/c1-6(2)7-4-3-5-8(10)9(7)11;/h3-5H,10-11H2,1-2H3;/q-1;.
What are the key properties of 3-propan-2-ylbenzene-1,2-diamine;tungsten?
3-propan-2-ylbenzene-1,2-diamine;tungsten has a molecular weight of 333.06 g/mol, XLogP of 1.81, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-ylbenzene-1,2-diamine;tungsten is sourced from PubChem (CID 59946286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).