C15H12F3N7OS2 — CID 59946815
2,2,2-trifluoro-N'-[4-[[3-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]sulfanylamino]phenyl]acetohydrazide (PubChem CID 59946815) has the molecular formula C15H12F3N7OS2 and a molecular weight of 427.44 g/mol. Its IUPAC name is 2,2,2-trifluoro-N'-[4-[[3-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]sulfanylamino]phenyl]acetohydrazide.
| Compound Name | 2,2,2-trifluoro-N'-[4-[[3-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]sulfanylamino]phenyl]acetohydrazide |
|---|---|
| PubChem CID | 59946815 |
| Molecular Formula | C15H12F3N7OS2 |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | 2,2,2-trifluoro-N'-[4-[[3-(5-sulfanylidene-2H-tetrazol-1-yl)phenyl]sulfanylamino]phenyl]acetohydrazide |
| SMILES | O=C(NNc1ccc(NSc2cccc(-n3[nH]nnc3=S)c2)cc1)C(F)(F)F |
| InChI | InChI=1S/C15H12F3N7OS2/c16-15(17,18)13(26)20-19-9-4-6-10(7-5-9)22-28-12-3-1-2-11(8-12)25-14(27)21-23-24-25/h1-8,19,22H,(H,20,26)(H,21,24,27) |
| InChIKey | PBJBNKNQLLSMAJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|