About [5,6-dimethyl-3-oxo-4-(2-oxo-2-piperidin-1-ylethyl)pyrazin-2-yl]azanide;tungsten
[5,6-dimethyl-3-oxo-4-(2-oxo-2-piperidin-1-ylethyl)pyrazin-2-yl]azanide;tungsten (PubChem CID 59948010) has the molecular formula C13H19N4O2W-
and a molecular weight of 447.16 g/mol. Its IUPAC name is [5,6-dimethyl-3-oxo-4-(2-oxo-2-piperidin-1-ylethyl)pyrazin-2-yl]azanide;tungsten.
Molecular Properties
| Compound Name | [5,6-dimethyl-3-oxo-4-(2-oxo-2-piperidin-1-ylethyl)pyrazin-2-yl]azanide;tungsten |
| PubChem CID | 59948010 |
| Molecular Formula | C13H19N4O2W- |
| Molecular Weight | 447.16 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | [5,6-dimethyl-3-oxo-4-(2-oxo-2-piperidin-1-ylethyl)pyrazin-2-yl]azanide;tungsten |
| SMILES | Cc1nc([NH-])c(=O)n(CC(=O)N2CCCCC2)c1C.[W] |
| InChI | InChI=1S/C13H19N4O2.W/c1-9-10(2)17(13(19)12(14)15-9)8-11(18)16-6-4-3-5-7-16;/h3-8H2,1-2H3,(H-,14,15);/q-1; |
| InChIKey | PXCFATFJWXIGIV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 79.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.16 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5,6-dimethyl-3-oxo-4-(2-oxo-2-piperidin-1-ylethyl)pyrazin-2-yl]azanide;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5,6-dimethyl-3-oxo-4-(2-oxo-2-piperidin-1-ylethyl)pyrazin-2-yl]azanide;tungsten?
The IUPAC name of [5,6-dimethyl-3-oxo-4-(2-oxo-2-piperidin-1-ylethyl)pyrazin-2-yl]azanide;tungsten (CID 59948010) is [5,6-dimethyl-3-oxo-4-(2-oxo-2-piperidin-1-ylethyl)pyrazin-2-yl]azanide;tungsten.
What is the SMILES notation for [5,6-dimethyl-3-oxo-4-(2-oxo-2-piperidin-1-ylethyl)pyrazin-2-yl]azanide;tungsten?
The canonical SMILES for [5,6-dimethyl-3-oxo-4-(2-oxo-2-piperidin-1-ylethyl)pyrazin-2-yl]azanide;tungsten is Cc1nc([NH-])c(=O)n(CC(=O)N2CCCCC2)c1C.[W].
What is the InChIKey of [5,6-dimethyl-3-oxo-4-(2-oxo-2-piperidin-1-ylethyl)pyrazin-2-yl]azanide;tungsten?
The InChIKey is PXCFATFJWXIGIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N4O2.W/c1-9-10(2)17(13(19)12(14)15-9)8-11(18)16-6-4-3-5-7-16;/h3-8H2,1-2H3,(H-,14,15);/q-1;.
What are the key properties of [5,6-dimethyl-3-oxo-4-(2-oxo-2-piperidin-1-ylethyl)pyrazin-2-yl]azanide;tungsten?
[5,6-dimethyl-3-oxo-4-(2-oxo-2-piperidin-1-ylethyl)pyrazin-2-yl]azanide;tungsten has a molecular weight of 447.16 g/mol, XLogP of 1.55, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5,6-dimethyl-3-oxo-4-(2-oxo-2-piperidin-1-ylethyl)pyrazin-2-yl]azanide;tungsten is sourced from PubChem (CID 59948010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).